Per-compound provenance: structure, identifiers, taxonomy, license tier, ChemBERTa-similar neighbors, ADMET predictions, and external cross-references.
[(3S,3aR,4S,5aR,9bS)-3,5a,9-trimethyl-2,6-dioxo-3a,4,5,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-4-yl] acetate
Synonyms: No synonyms reported
THEO_0000002 plant CC BY-NC 4.0Structure
| SMILES | CC(=O)O[C@H]1C[C@@]2(C)C(=O)CCC(C)=C2[C@H]2OC(=O)[C@@H](C)[C@H]12 |
|---|---|
| InChIKey | ATWFGCRPHGGEQP-BZDSGMRHSA-N |
Properties
| Exact mass | 306.15 |
|---|---|
| LogP | 2.19 |
| TPSA | 69.7 |
| HBA | 5.0 |
| HBD | 0.0 |
| Rings | 3.0 |
| Rotatable bonds | 1.0 |
Provenance
| Primary source | COCONUT |
|---|---|
| Also found in | COCONUT ANPDB LOTUS |
| Attested species | Artemisia herba-alba |
| Geographic regions | Africa, Europe |
| References | 10.1021/NP50109A010 10.1021/np50109a010 |
| License | CC BY-NC 4.0 |
| License provenance |
Resolved via most-restrictive-wins across 3 attesting sources.
ANPDB:
CC BY-NC 4.0
COCONUT:
CC BY 4.0
LOTUS:
CC BY 4.0
|
Taxonomic classification
| Kingdom | plant (resolved) |
|---|---|
| Phylum | Streptophyta (resolved) |
| Class | Magnoliopsida (resolved) |
| Order | Asterales (resolved) |
| Family | Asteraceae (resolved) |
| Genus | Artemisia (resolved) |
| Attested genera | Artemisia |
| Attested families | Asteraceae |
| Native to (continents) | Africa, Europe (WCVP) |
| Native to (regions) | Macaronesia, Northern Africa, Southwestern Europe (WCVP TDWG level 2) |
Chemical classification
Eudesmane sesquiterpenoids
Curated
Sesquiterpenoids
→ Terpenoids
Chemical class (see Help for how classes are assigned)
| NPClassifier class | Eudesmane sesquiterpenoids |
|---|---|
| NPClassifier superclass | Sesquiterpenoids |
| NPClassifier pathway | Terpenoids |
| ClassyFire superclass | Lipids and lipid-like molecules |
| Inferred class | — |
NPClassifier hierarchy
- Eudesmane sesquiterpenoids → Sesquiterpenoids → Terpenoids
ADMET Predictions (ADMET-AI)
| Lipinski | 4.0000 |
|---|---|
| QED | 0.5484 |
| stereo_centers | 5.0000 |
| PAINS_alert | 0.0000 |
| BRENK_alert | 1.0000 |
| NIH_alert | 0.0000 |
| AMES | 0.5118 |
| BBB_Martins | 0.9392 |
| Bioavailability_Ma | 0.8795 |
| CYP1A2_Veith | 0.0384 |
| CYP2C19_Veith | 0.1241 |
| CYP2C9_Substrate_CarbonMangels | 0.1903 |
| CYP2C9_Veith | 0.0366 |
| CYP2D6_Substrate_CarbonMangels | 0.2793 |
| CYP2D6_Veith | 0.0417 |
| CYP3A4_Substrate_CarbonMangels | 0.6862 |
| CYP3A4_Veith | 0.1593 |
| Carcinogens_Lagunin | 0.0663 |
| ClinTox | 0.1638 |
| DILI | 0.3451 |
| HIA_Hou | 0.9998 |
| NR_AR_LBD | 0.0352 |
| NR_AR | 0.0826 |
| NR_AhR | 0.0162 |
| NR_Aromatase | 0.0286 |
| NR_ER_LBD | 0.0153 |
| NR_ER | 0.0821 |
| NR_PPAR_gamma | 0.0117 |
| PAMPA_NCATS | 0.9581 |
| Pgp_Broccatelli | 0.1483 |
| SR_ARE | 0.1200 |
| SR_ATAD5 | 0.0166 |
| SR_HSE | 0.0242 |
| SR_MMP | 0.0263 |
| SR_p53 | 0.0299 |
| Skin_Reaction | 0.5406 |
| hERG | 0.3046 |
| Caco2_Wang | -4.1191 |
| Clearance_Hepatocyte_AZ | 88.1993 |
| Clearance_Microsome_AZ | 53.2801 |
| Half_Life_Obach | 0.0000 (raw: -6.8519) |
| HydrationFreeEnergy_FreeSolv | -8.5009 |
| LD50_Zhu | 2.0397 |
| Lipophilicity_AstraZeneca | 1.3000 |
| PPBR_AZ | 57.5060 |
| Solubility_AqSolDB | -2.4714 |
| VDss_Lombardo | 0.0000 (raw: -3.4132) |